| Product Name | 3aalpha,4,7,7aalpha-Tetrahydro-4alpha,7alpha-methanoisobenzofuran-1,3-d one |
| Alias | 5-Norbornene-2,3-dicarboxylic Anhydride;Carbic anhydride;Himic anhydride;Nadic anhydride |
| CAS | 129-64-6;826-62-0 |
| EINECS | 204-957-7 |
| Chemical Formula | C9H8O3 |
| Molecular Weight | 164.158 |
| inchi | InChI=1/C9H8O3/c10-8-6-4-1-2-5(3-4)7(6)9(11)12-8/h1-2,4-7H,3H2/t4-,5+,6?,7? |
| Package | Email to quote |
| Price | Email to quote |
| Descriptions | |
| Last Update | 2021-11-09 17:37:31 |
| Supplier Name | Henan Research New Material Co., Ltd |
| Tel | |
| Mobile | +86 18137458807 |
| Fax | |
| sales021@researchvip.com | |
| Website | http://www.researchvip.com |