| Supplier Name | Handan Huajun Chemicals Co.,Ltd |
| Tel | |
| Mobile | 18630058311 |
| hdhjchem@yeah.net | |
| Website | http://huajunchem.com |
| Product Name | Octanoic acid, sodium salt |
| Synonyms | Wodium caprylate Sodium caprylate sodium octanoate N-OCTANOATESODIUM Sodium n-octanoate Sodium n-caprylate Bitterness of sodiuM |
| CAS | 1984-06-1 |
| EINECS | 217-850-5 |
| Chemical Formula | C8H15NaO2 |
| Molecular Weight | 166.19 |
| inchi | InChI=1/C8H16O2.Na/c1-2-3-4-5-6-7-8(9)10;/h2-7H2,1H3,(H,9,10) |
| Package | 25kg |
| Price | Email to quote |
| Descriptions | |
| Supplier Website | |
| Last Update | 2023-04-27 18:30:20 |