| Supplier Name | Jinan Finer Chemical Co., Ltd |
| Tel | 0531-88989535 |
| Mobile | 15662658101 |
| sales@finerchem.com | |
| Website | http://www.finerchem.com |
| Product Name | Carbohydrazide |
| Synonyms | CBH Cabazide Carbazide Carbohydrozide Carbohydrazide 1,3-diaminourea 1,3-diamino-ure |
| CAS | 497-18-7 |
| EINECS | 207-837-2 |
| Chemical Formula | CH6N4O |
| Molecular Weight | 90.08 |
| inchi | InChI=1/CH6N4O/c2-4-1(6)5-3/h2-3H2,(H2,4,5,6) |
| Package | Email to quote |
| Price | Email to quote |
| Descriptions | |
| Supplier Website | |
| Last Update | 2023-04-27 18:30:20 |