| Supplier Name | XiangYang King Success Fine Chemical co., ltd. |
| Tel | 0710-3510276 |
| Mobile | 19871282568 |
| sales_kingsuccess@163.com | |
| Website | http://www.king-success.com/ |
| Product Name | 2-Methyl-2-propen-1-ol |
| Synonyms | MAOH Isobutenol methacrylalcohol Methallyl alcohol Isopropenyl carbinol 2-Methylallyl alcohol 2-Methyl-2-propen-1-ol |
| CAS | 513-42-8 |
| EINECS | 208-161-0 |
| Chemical Formula | C4H8O |
| Molecular Weight | 72.1057 |
| inchi | InChI=1/C4H8O/c1-4(2)3-5/h5H,1,3H2,2H3 |
| Package | Email to quote |
| Price | Email to quote |
| Descriptions | |
| Supplier Website | |
| Last Update | 2023-04-27 18:30:20 |