| Supplier Name | |
| Tel | 86-027-50756190 |
| Mobile | 18872220674 |
| 567@ycphar.com | |
| Website | http:// |
| Product Name | 4-Aminobenzoic acid |
| Synonyms | PABA H-4-Abz-OH The aMino acid 4-carboxyanilin 4-aminobenzoate p-Aminobenzoic acid Folic acid Impurity |
| CAS | 150-13-0 |
| EINECS | 205-753-0 |
| Chemical Formula | C7H7NO2 |
| Molecular Weight | 137.14 |
| inchi | InChI=1/C7H7NO2/c8-6-3-1-5(2-4-6)7(9)10/h1-4H,8H2,(H,9,10)/p-1 |
| Package | 25kg |
| Price | Email to quote |
| Descriptions | |
| Supplier Website | |
| Last Update | 2023-04-27 18:30:20 |