Supplier Name | Hebei Zhentian Food Addit Co., Ltd |
Contact | No.1 Development Avenue, Guangzong County, |
Tel | +86 13313090628 |
Mobile | +86 13313090628 |
13313091926@163.com | |
Website | http://http://www.chian2699.com |
13373390591 | |
18733928930 |
Product Name | Schizandrin B |
Synonyms | Wuweizisu B Schizandrin B Schisandrin B gamma-Schisandrin gamma-Schizandrin Schisandrin B (Sch B) 6,7-dimethyl-, stereoisomer |
CAS | 61281-37-6 |
EINECS | |
Chemical Formula | C23H28O6 |
Molecular Weight | 400.47 |
inchi | InChI=1/C23H28O6/c1-12-7-14-9-16(24-3)20(25-4)22(26-5)18(14)19-15(8-13(12)2)10-17-21(23(19)27-6)29-11-28-17/h9-10,12-13H,7-8,11H2,1-6H3/t12-,13+/m0/s1 |
Package | Email to quote |
Price | Email to quote |
Descriptions | |
Last Update | 2024-04-29 16:10:35 |