Supplier Name | Zhejiang Hangyu API Co., Ltd |
Contact | vinnie |
Tel | +86 13293139565 |
Mobile | |
vinnie@api-made.com | |
Website | http://postmaster@api-made.com/ |
+86 13293139565 |
Product Name | methyl violet B base |
Synonyms | CI 42535B SOLVENT VIOLET 8 Elbasol Violet B Solvent Violet 8 C.I.Solventviolet8 Aizen SOT Violet-1 methyl violet B base |
CAS | 52080-58-7 |
EINECS | |
Chemical Formula | |
Molecular Weight | 355.48 |
inchi | InChI=1/C24H27N3/c1-25-21-12-6-18(7-13-21)24(19-8-14-22(15-9-19)26(2)3)20-10-16-23(17-11-20)27(4)5/h6-17H,1-5H3 |
Package | Email to quote |
Price | Email to quote |
Descriptions | |
Last Update | 2024-04-25 16:00:27 |