Name | trans-1,2-cyclopentanediol |
Synonyms | AI3-26281 1,2-Cyclopentanediol cyclopentane-1,2-diol Cyclopentane-1,2-diol trans-Cyclopentanediol-1,2 TRANS-1,2-CYCLOPENTANEDIOL trans-1,2-cyclopentanediol trans-Cyclopentane-1,2-diol trans-cyclopentane-1,2-diol rel-(1R*,2R*)-1,2-Cyclopentanediol rel-(1S*,2S*)-Cyclopentane-1,2-diol |
CAS | 5057-99-8 |
EINECS | 225-757-6 |
InChI | InChI=1/C5H10O2/c6-4-2-1-3-5(4)7/h4-7H,1-3H2 |
InChIKey | VCVOSERVUCJNPR-RFZPGFLSSA-N |
Molecular Formula | C5H10O2 |
Molar Mass | 102.13 |
Density | 1.235 |
Melting Point | 54-56°C(lit.) |
Boling Point | 136°C21.5mm Hg(lit.) |
Flash Point | >230°F |
Vapor Presure | 0.0304mmHg at 25°C |
pKa | 14.48±0.40(Predicted) |
Storage Condition | 2-8°C |
Stability | Stable. Combustible. Incompatible with strong oxidizing agents. |
Refractive Index | 1. |
Safety Description | S22 - Do not breathe dust. S24/25 - Avoid contact with skin and eyes. |
WGK Germany | 3 |
FLUKA BRAND F CODES | 3-4.3-10 |