Name | tetradecanophenone |
Synonyms | MYRISTOPHENONE tetradecanophenone N-TETRADECANOPHENONE Tridecyl phenyl ketone Ketone, phenyl tridecyl 1-phenyl-1-tetradecanon PHENYL N-TRIDECYL KETONE 1-Phenyl-1-tetradecanone 1-Tetradecanone, 1-phenyl- |
CAS | 4497-05-6 |
EINECS | 224-790-3 |
InChI | InChI=1/C20H32O/c1-2-3-4-5-6-7-8-9-10-11-15-18-20(21)19-16-13-12-14-17-19/h12-14,16-17H,2-11,15,18H2,1H3 |
Molecular Formula | C20H32O |
Molar Mass | 288.47 |
Density | 0.9262 (rough estimate) |
Melting Point | 46-52°C(lit.) |
Boling Point | 212°C12mm Hg(lit.) |
Flash Point | >230°F |
Vapor Presure | 2.17E-05mmHg at 25°C |
Appearance | powder to crystal |
Color | White to Almost white |
Storage Condition | Room Temprature |
Refractive Index | 1.4880 (estimate) |
MDL | MFCD00008985 |
WGK Germany | 3 |