Ethyl 6-amino-5-chloro-2-(4-chlorophenyl)-4-pyrimidinecarboxylate
Ethyl 6-amino-5-chloro-2-(4-chlorophenyl)pyrimidine-4-carboxylate
CAS: 858955-37-0
Molecular Formula: C13H11Cl2N3O2
Ethyl 6-amino-5-chloro-2-(4-chlorophenyl)-4-pyrimidinecarboxylate - Names and Identifiers
| Name | Ethyl 6-amino-5-chloro-2-(4-chlorophenyl)pyrimidine-4-carboxylate |
| Synonyms | Ethyl 6-amino-5-chloro-2-(4-chlorophenyl)pyrimidine-4-carboxylate Ethyl 6-amino-5-chloro-2-(4-chlorophenyl)-4-pyrimidinecarboxylate ETHYL 6-AMINO-5-CHLORO-2-(4-CHLOROPHENYL)PYRIMIDINE-4-CARBOXYLATE 6-Amino-5-chloro-2-(4-chloro-phenyl)-pyrimidine-4-carboxylic acid ethyl ester 4-Pyrimidinecarboxylic acid, 6-amino-5-chloro-2-(4-chlorophenyl)-, ethyl ester |
| CAS | 858955-37-0 |
| InChI | InChI=1S/C13H11Cl2N3O2/c1-2-20-13(19)10-9(15)11(16)18-12(17-10)7-3-5-8(14)6-4-7/h3-6H,2H2,1H3,(H2,16,17,18) |
Ethyl 6-amino-5-chloro-2-(4-chlorophenyl)-4-pyrimidinecarboxylate - Physico-chemical Properties
| Molecular Formula | C13H11Cl2N3O2 |
| Molar Mass | 312.15 |
| Storage Condition | 2-8°C |
| Sensitive | IRRITANT |
| MDL | MFCD17014804 |
Ethyl 6-amino-5-chloro-2-(4-chlorophenyl)-4-pyrimidinecarboxylate - Introduction
Ethyl 6-amino-5-chloro-2-(4-chlorophenyl)pyrimidine-4-carboxylate is an organic compound with the chemical formula C13H10Cl2N4O2.
Nature:
1. Appearance: Ethyl 6-amino-5-chloro-2-(4-chlorophenyl)pyrimidine-4-carboxylate is a white to off-white solid.
2. Solubility: It has high solubility in some organic solvents, such as ethanol, dimethyl sulfoxide and dichloromethane, but has low solubility in water.
Use:
Ethyl 6-amino-5-chroo-2-(4-chroophenyl) pyrimidine-4-carboxylate is an intermediate with potential pharmaceutical activity and can be used to synthesize various drugs. It is widely used in the research and development of medical fields, such as anti-cancer drugs, anti-viral drugs, etc.
Preparation Method:
Ethyl 6-amino-5-chloro-2-(4-chlorophenyl)pyrimidine-4-carboxylate can be obtained by a variety of synthetic methods, depending on the desired synthetic route and conditions. A common preparation method is the reaction of ethyl carbamate with 2-(4-chlorophenyl)-5-chloropyrimidine under appropriate reaction conditions.
Safety Information:
1. Ethyl 6-amino-5-chloro-2-(4-chlorophenyl)pyrimidine-4-carboxylate is generally non-irritating under normal use conditions.
2. use should pay attention to personal protective measures, avoid contact with skin and eyes.
3. Pay attention to good ventilation conditions during operation.
4. If ingested or inhaled by mistake, seek medical attention immediately.
Nature:
1. Appearance: Ethyl 6-amino-5-chloro-2-(4-chlorophenyl)pyrimidine-4-carboxylate is a white to off-white solid.
2. Solubility: It has high solubility in some organic solvents, such as ethanol, dimethyl sulfoxide and dichloromethane, but has low solubility in water.
Use:
Ethyl 6-amino-5-chroo-2-(4-chroophenyl) pyrimidine-4-carboxylate is an intermediate with potential pharmaceutical activity and can be used to synthesize various drugs. It is widely used in the research and development of medical fields, such as anti-cancer drugs, anti-viral drugs, etc.
Preparation Method:
Ethyl 6-amino-5-chloro-2-(4-chlorophenyl)pyrimidine-4-carboxylate can be obtained by a variety of synthetic methods, depending on the desired synthetic route and conditions. A common preparation method is the reaction of ethyl carbamate with 2-(4-chlorophenyl)-5-chloropyrimidine under appropriate reaction conditions.
Safety Information:
1. Ethyl 6-amino-5-chloro-2-(4-chlorophenyl)pyrimidine-4-carboxylate is generally non-irritating under normal use conditions.
2. use should pay attention to personal protective measures, avoid contact with skin and eyes.
3. Pay attention to good ventilation conditions during operation.
4. If ingested or inhaled by mistake, seek medical attention immediately.
Last Update：2024-04-09 02:00:48
Supplier List
View History
Ethyl 6-amino-5-chloro-2-(4-chlorophenyl)-4-pyrimidinecarboxylate
2,3,4,9-tetrahydro-1H-carbazole-8-carboxylic acid(SALTDATA: FREE)
tert-butyl 5-oxopyrrolidin-3-ylcarbamate
10187-89-0
Ethyl 5-thiazolecarboxylate
methyl 2-O-(beta-glucopyranosyl)-6-O-(alpha-rhamnopyranosyl)-alpha-glucopyranoside
5-Thiazolecarboxamide,2-methyl-N-[(1R,2S)-2-phenylcyclopropyl]-,rel-(9CI)
950782-86-2
2(3H)-Furanone,5-ethyldihydro-3-(phenylmethoxy)-,(3R,5R)-rel-(9CI)
3-(2,6-dichlorophenyl)-6-iodo-2-methyl-4(3H)-quinazolinone
2,3,4,9-tetrahydro-1H-carbazole-8-carboxylic acid(SALTDATA: FREE)
tert-butyl 5-oxopyrrolidin-3-ylcarbamate
10187-89-0
Ethyl 5-thiazolecarboxylate
methyl 2-O-(beta-glucopyranosyl)-6-O-(alpha-rhamnopyranosyl)-alpha-glucopyranoside
5-Thiazolecarboxamide,2-methyl-N-[(1R,2S)-2-phenylcyclopropyl]-,rel-(9CI)
950782-86-2
2(3H)-Furanone,5-ethyldihydro-3-(phenylmethoxy)-,(3R,5R)-rel-(9CI)
3-(2,6-dichlorophenyl)-6-iodo-2-methyl-4(3H)-quinazolinone