Disalicylalethylenediamineiron - Names and Identifiers
Name | Disalicylalethylenediamineiron
|
Synonyms | disalicylalethylenediamineiron Disalicylalethylenediamineiron N,N-Disalicylal-ethylenediamine iron(II) N,N'-DISALICYLAL-ETHYLENEDIAMINE IRON(II) N,N'-ETHYLENEBIS(SALICYLIDENEIMINATO) IRON(II) N,N'-BIS(SALICYLIDENE)ETHYLENEDIAMINE IRON(II) N,N'-Bis(salicylidene)ethylenediamine iron salt N,N'-Bis(salicylidene)ethylenediamine Iron(II)Discontinued iron(2+) 2,2'-{ethane-1,2-diylbis[nitrilo(E)methylylidene]}diphenolate N,N'-Disalicylalethylenediamine Iron(II)N,N'-Ethylenebis(salicylideneiminato)iron(II) iron(2+),6-[[2-[(6-oxocyclohexa-2,4-dien-1-ylidene)methylamino]ethylamino]methylidene]cyclohexa-2,4-dien-1-one
|
CAS | 14167-12-5
|
InChI | InChI=1/C16H16N2O2.Fe/c19-15-7-3-1-5-13(15)11-17-9-10-18-12-14-6-2-4-8-16(14)20;/h1-8,11-12,19-20H,9-10H2;/q;+2/p-2/b17-11+,18-12+ |
Disalicylalethylenediamineiron - Physico-chemical Properties
Molecular Formula | C16H14FeN2O2
|
Molar Mass | 322.15 |
Boling Point | 448.8°C at 760 mmHg |
Flash Point | 294.1°C |
Vapor Presure | 1.14E-08mmHg at 25°C |
Disalicylalethylenediamineiron - Introduction
Two salicylaldehyde ethylenediamine iron is an organic iron complex, the chemical formula is Fe(C10H8N2O2)2. Its nature is as follows:
1. appearance: two salicylaldehyde ethylenediamine iron is a black solid.
2. Stability: relatively stable at room temperature, but sensitive to light, heat and oxygen.
3. Solubility: Soluble in some organic solvents, such as ethanol, methanol and dimethylformamide.
The main uses of two salicylaldehyde ethylenediamine iron are as follows:
1. Catalyst: As a catalyst, it is commonly used in the hydroxyl methylation reaction of phenol.
2. Dyes: Due to their black properties, they can be used as dyes and dye precursors.
3. pharmaceutical field: in the field of medicine, disalicylaldehyde ethylenediamine iron is also used as an iron carrier.
The preparation method of disalicylaldehyde ethylenediamine iron is generally obtained by reacting disalicylaldehyde with ethylenediamine. Specific preparation methods include:
1. the right amount of two salicylaldehyde and ethylenediamine dissolved in a suitable organic solvent, such as ethanol or ether.
2. under stirring, slowly add some acidic catalyst, such as hydrochloric acid or sulfuric acid.
3. reaction, the color will change from colorless to black. After completion of the reaction, the precipitate can be separated by filtration or centrifugation.
4. The separated precipitate can be washed with an appropriate organic solvent to remove impurities.
It should be noted that the following safety information should be paid attention to when using, storing and disposing of disalicylaldehyde ethylenediamine iron:
1. avoid contact with skin, eyes or respiratory system, should wear personal protective equipment, including gloves, protective glasses and masks.
2. During operation, avoid inhaling the dust or vapor of the solution.
3. should be stored properly, avoid contact with oxygen, light and heat source.
4. Avoid mixing with flammable substances and oxidants to prevent fire or explosion.
5. Waste shall be disposed in accordance with national and local regulations.
Last Update:2024-04-09 21:21:28