Name | N-Methyl-4-amino-2-fluoro-benzamide |
Synonyms | Enzalutamide ITS-3 Enzalutamide Impurity 20 n-methyl-2-fluoro-4-aminobenzamide 4-amino-2-fluoro-n-methylbenzamide 4-AMINO-2-FLUORO-N-METHYLBENZAMIDE N-Methyl-2-fluoro-4-aminobenzamide 4-amino-2-fluoro-N-menthylbenzamide N-Methyl-4-amino-2-fluoro-benzamide 2. 4-aMino-2-fluoro-N-MethylbenzaMide BenzaMide, 4-aMino-2-fluoro-N-Methyl- |
CAS | 915087-25-1 |
InChI | InChI=1S/C8H9FN2O/c1-11-8(12)6-3-2-5(10)4-7(6)9/h2-4H,10H2,1H3,(H,11,12) |
Molecular Formula | C8H9FN2O |
Molar Mass | 168.17 |
Density | 1.234 |
Melting Point | 160 - 163°C |
Boling Point | 320℃ |
Flash Point | 147℃ |
Solubility | Chloroform (Slightly), Methanol (Slightly) |
Appearance | Solid |
Color | White to Off-White |
pKa | 14.12±0.46(Predicted) |
Storage Condition | Keep in dark place,Inert atmosphere,Room temperature |
Stability | Moisture Sensitive |
Use | This product is for scientific research only and shall not be used for other purposes. |