Name | Methyl 5-bromo-2-nitrobenzoate |
Synonyms | Methyl 5-bromo-2-nitrobenzoate Methyl 2-nitro-5-broMobenzoate 5-Bromo-2-nitro-benzoic acid met 2-Nitro-5-bromobenzoic acid methyl ester 5-BROMO-2-NITRO-BENZOIC ACID METHYL ESTER Benzoic acid, 5-bromo-2-nitro-, methyl ester |
CAS | 883554-93-6 |
InChI | InChI=1/C8H6BrNO4/c1-14-8(11)6-4-5(9)2-3-7(6)10(12)13/h2-4H,1H3 |
Molecular Formula | C8H6BrNO4 |
Molar Mass | 260.04 |
Density | 1.673g/cm3 |
Melting Point | 70-71°C |
Boling Point | 314°C at 760 mmHg |
Flash Point | 143.7°C |
Vapor Presure | 0.000481mmHg at 25°C |
Storage Condition | Sealed in dry,Room Temperature |
Refractive Index | 1.587 |
Overview | methyl 5-bromo-2-nitrobenzoate is an ester compound useful as an intermediate in the synthesis of pharmaceuticals. |
Use | methyl 5-bromo-2-nitrobenzoate can be used as a pharmaceutical synthesis intermediate, such as the synthesis of benzydamine impurity B intermediate compound V. |