Name | Siberian Ginseng Extract |
Synonyms | acanthoside B Acanthoside B ELEUTHEROSIDE E1 ELEUTHEROSIDE B+E Siberian Ginseng Extract (+)-Syringaresinol O-beta-D-glucoside 4-[(1S,3aR,4S,6aR)-4-(4-hydroxy-3,5-dimethoxyphenyl)tetrahydro-1H,3H-furo[3,4-c]furan-1-yl]-2,6-dimethoxyphenyl beta-D-glucopyranoside (2S,3R,4S,5S,6R)-2-[4-[(3S,3aR,6S,6aR)-3-(4-hydroxy-3,5-dimethoxyphenyl)-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]furan-6-yl]-2,6-dimethoxyphenoxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
CAS | 7374-79-0 |
InChI | InChI=1/C28H36O13/c1-34-16-5-12(6-17(35-2)21(16)30)25-14-10-39-26(15(14)11-38-25)13-7-18(36-3)27(19(8-13)37-4)41-28-24(33)23(32)22(31)20(9-29)40-28/h5-8,14-15,20,22-26,28-33H,9-11H2,1-4H3/t14-,15-,20+,22+,23-,24+,25+,26+,28-/m0/s1 |
Molecular Formula | C28H36O13 |
Molar Mass | 580.58 |
Density | 1.399±0.06 g/cm3(Predicted) |
Melting Point | 182-183 °C |
Boling Point | 778.5±60.0 °C(Predicted) |
Flash Point | 424.6°C |
Solubility | Soluble in methanol, ethanol, DMSO and other organic solvents |
Vapor Presure | 1.63E-25mmHg at 25°C |
Appearance | Powder |
pKa | 9.85±0.40(Predicted) |
Storage Condition | 2-8℃ |
Refractive Index | 1.6 |
Reference Show more | 1. [IF=3.935] Yong-Sheng Wu et al."Chemical profiling of Callicarpa nudiflora and its effective compounds identification by compound-target network analysis."J Pharmaceut Biomed. 2020 Apr;182:113110 |