Name | S(+)-2-chloro-1-phenylethanol |
Synonyms | (S)-2-Chloro-1-phenylethanol (S)-1-Phenyl-2-chloroethanol S(+)-2-CHLORO-1-PHENYLETHANOL S(+)-2-chloro-1-phenylethanol (S)-2-CHLORO-1-PHENYL-ETHANOL (1S)-2-chloro-1-phenylethanol (1S)-2-Chloro-1-phenylethanol (S)-(+)-2-Chloro-1-phenylethanol (s)-(+)-α-(chloromethyl)benzenemethanol S(+)-ALPHA-(CHLOROMETHYL)BENZENEMETHANOL (alphaS)-alpha-Chloromethylbenzenemethanol (S)-(+)-2-chloro-1-phenylethanol (S)-2-CHLORO-1-PHENYL-ETHANOL |
CAS | 70111-05-6 |
InChI | InChI=1/C8H9ClO/c9-6-8(10)7-4-2-1-3-5-7/h1-5,8,10H,6H2/t8-/m1/s1 |
InChIKey | XWCQSILTDPAWDP-MRVPVSSYSA-N |
Molecular Formula | C8H9ClO |
Molar Mass | 156.61 |
Density | 1.185g/mLat 25°C(lit.) |
Boling Point | 255℃ |
Flash Point | 113°C |
Vapor Presure | 0.00869mmHg at 25°C |
BRN | 3648988 |
pKa | 13.21±0.20(Predicted) |
Storage Condition | 2-8°C |
Refractive Index | n20/D 1.550(lit.) |
Safety Description | S23 - Do not breathe vapour. S24/25 - Avoid contact with skin and eyes. |
WGK Germany | 3 |