Name | myristyl acetate |
Synonyms | AI3-11586 UNII-G9O55CT350 MYRISTYL ACETATE Myristyl acetate myristyl acetate Tetradecyl acetate TETRADECYL ACETATE Tetradecanol acetate 1-Tetradecyl acetate 1-tetradecanol,acetate 1-tetradecanyl acetate 1-Tetradecanol, acetate 1-Tetradecanol, 1-acetate aceticacidtetradecylester acetic acid myristyl ester |
CAS | 638-59-5 |
EINECS | 211-344-8 |
InChI | InChI=1/C16H32O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-18-16(2)17/h3-15H2,1-2H3 |
Molecular Formula | C16H32O2 |
Molar Mass | 256.42 |
Density | 0.8561 (estimate) |
Melting Point | 14°C |
Boling Point | 299.67°C (estimate) |
Flash Point | 133.6°C |
Solubility | Chloroform (Slightly), Methanol (Slightly) |
Vapor Presure | 0.00115mmHg at 25°C |
Appearance | liquid |
Color | Clear Colourless |
Storage Condition | Sealed in dry,Room Temperature |
Refractive Index | 1.4352 (estimate) |
WGK Germany | 3 |
EPA chemical substance information | information provided by: ofmpeb.epa.gov (external link) |
biological activity | Tetradecyl acetate is a sexual pheromone produced by female ctenostiobliqua that can be used to disrupt mating of pests. |