6-Chloro-9-(2,3,5-tri-O-benzoyl-2-C-Methyl-β-D-ribofuranosyl)-9H-purine - Names and Identifiers
Name | 6-Chloro-9-(2,3,5-tri-O-benzoyl-2-C-methyl-beta-D-ribofuranosyl)-9H-purine
|
Synonyms | 6-Chloro-9-(2,3,5-tri-O-benzoyl-2-C-methyl-β-D-ribofuranosyl)-9H-purine 6-Chloro-9-(2,3,5-tri-O-benzoyl-2-C-Methyl-β-D-ribofuranosyl)-9H-purine 6-Chloro-9-(2,3,5-tri-O-benzoyl-2-b-C-methyl-β-D-ribofuranosyl)-9H-purine 9H-Purine, 6-chloro-9-(2,3,5-tri-O-benzoyl-2-C-methyl-β-D-ribofuranosyl)- 6-CHLORO-9-(2,3,5-TRI-O-BENZOYL-2-C-METHYL-BETA-D-RIBOFURANOSYL)-9H-PURINE 6-Chloro-9-(2,3,5-tri-O-benzoyl-2-C-methyl-beta-D-ribofuranosyl)-9H-purine 9H-purine, 6-chloro-9-(2,3,5-tri-O-benzoyl-2-C-methyl-beta-D-ribofuranosyl)- (2R,3R,4R,5R)-5-((benzoyloxy)methyl)-2-(6-chloro-9H-purin-9-yl)-3-methyltetrahydrofuran-3,4-diyl dibenzoate
|
CAS | 205171-04-6
|
InChI | InChI=1/C32H25ClN4O7/c1-32(44-30(40)22-15-9-4-10-16-22)25(43-29(39)21-13-7-3-8-14-21)23(17-41-28(38)20-11-5-2-6-12-20)42-31(32)37-19-36-24-26(33)34-18-35-27(24)37/h2-16,18-19,23,25,31H,17H2,1H3/t23-,25-,31-,32-/m1/s1 |
6-Chloro-9-(2,3,5-tri-O-benzoyl-2-C-Methyl-β-D-ribofuranosyl)-9H-purine - Physico-chemical Properties
Molecular Formula | C32H25ClN4O7
|
Molar Mass | 613.02 |
Density | 1.41 |
Boling Point | 757.022°C at 760 mmHg |
Flash Point | 411.632°C |
Vapor Presure | 0mmHg at 25°C |
Refractive Index | 1.667 |
6-Chloro-9-(2,3,5-tri-O-benzoyl-2-C-Methyl-β-D-ribofuranosyl)-9H-purine - Introduction
6-Chloro-9-(2,3,-)-9H-purine is an organic compound with the chemical formula C24H18ClN5O5. It has the following properties:
1. Appearance: 6-Chloro-9-(2,3, Bi)-9H-purine is a white solid.
2. Solubility: It is soluble in some polar organic solvents, such as ethanol and dimethyl sulfoxide.
3. Stability: It is relatively stable under dry conditions.
4. Chemical properties: 6-Chloro-9-(2,3,)-9H-purine is a ribonucleoside reverse transcriptase inhibitor, which can be used to inhibit the replication of HIV virus.
Its uses include:
1. Drug research: As a ribonucleoside reverse transcriptase inhibitor, it has important application value in the research of antiviral drugs.
2. Antiviral drugs: Due to its properties of inhibiting HIV virus replication, it can be used to develop anti-HIV drugs.
The method for preparing 6-Chloro-9-(2,3, phenyl)-9H-purine can be obtained by Ribosylation. The specific preparation method may vary depending on the purpose of the study and the experimental conditions.
in terms of safety information, the specific safety of 6-Chloro-9-(2,3, 5-1-9h-purine) often needs to be determined through experimental data. During use and handling, appropriate protective measures should be taken, such as wearing gloves, protective glasses and external ventilation facilities in the laboratory. Should be stored in a dry, cool place, away from fire and oxidizing agents. When handling this compound, observe applicable safety practices and consult professional advice.
Last Update:2024-04-09 20:11:46