Name | 2-(4-Fluorophenyl)thiophene |
Synonyms | T5SJ BR DF [WLN] 2-(4-Fluorphenyl)thiophen Thiophene, 2-(4-fluorophenyl)- |
CAS | 58861-48-6 |
InChI | InChI=1/C10H7FS/c11-9-5-3-8(4-6-9)10-2-1-7-12-10/h1-7H |
Molecular Formula | C10H7FS |
Molar Mass | 178.22 |
Density | 1.201g/cm3 |
Melting Point | 51.0-55.0℃ |
Boling Point | 252.316°C at 760 mmHg |
Flash Point | 106.397°C |
Vapor Presure | 0.031mmHg at 25°C |
Storage Condition | 2-8℃ |
Refractive Index | 1.578 |
MDL | MFCD06802535 |
Use | This product is for scientific research only and shall not be used for other purposes. |