Name | 2,6-Dichloro-3-methylpyridine |
Synonyms | 2,6-Dichloro-3-picoline 2,6-Dichloro-3-methylpyridine 2,6-DICHLORO-3-METHYLPYRIDINE 3-Methyl-2,6-dichloropyridine Pyridine,2,6-dichloro-3-methyl- pyridine, 2,6-dichloro-3-methyl- |
CAS | 58584-94-4 |
InChI | InChI=1/C6H5Cl2N/c1-4-2-3-5(7)9-6(4)8/h2-3H,1H3 |
Molecular Formula | C6H5Cl2N |
Molar Mass | 162.02 |
Density | 1.319±0.06 g/cm3(Predicted) |
Melting Point | 51.5-52.5 °C |
Boling Point | 110-116 °C(Press: 12 Torr) |
Flash Point | 117.1°C |
Water Solubility | Slightly soluble in water. |
Vapor Presure | 0.0873mmHg at 25°C |
Appearance | Solid |
pKa | -2.41±0.10(Predicted) |
Storage Condition | under inert gas (nitrogen or Argon) at 2-8°C |
Refractive Index | 1.547 |
use | 2,6-dichloro-3-methylpyridine is a heterocyclic derivative and can be used as a pharmaceutical intermediate. |