52916-16-2 - Names and Identifiers
Name | 2,2-Dimethyltetrahydro-2H-pyran-4-carboxylic acid
|
Synonyms | 2,2-dimethyloxane-4-carboxylic acid 2,2-dimethyl-4-tetrahydropyrancarboxylic acid 2,2-Dimethyltetrahydro-2H-pyran-4-carboxylic acid tetrahydro-2,2-dimethyl-2H-pyran-4-carboxylic acid 2H-Pyran-4-carboxylic acid, tetrahydro-2,2-dimethyl-
|
CAS | 52916-16-2
|
InChI | InChI=1/C8H14O3/c1-8(2)5-6(7(9)10)3-4-11-8/h6H,3-5H2,1-2H3,(H,9,10) |
52916-16-2 - Physico-chemical Properties
Molecular Formula | C8H14O3
|
Molar Mass | 158.2 |
Density | 1.067±0.06 g/cm3(Predicted) |
Melting Point | 102 °C |
Boling Point | 261.8±33.0 °C(Predicted) |
Flash Point | 102.9°C |
Vapor Presure | 0.00336mmHg at 25°C |
pKa | 4.45±0.40(Predicted) |
Storage Condition | Sealed in dry,Room Temperature |
Refractive Index | 1.453 |
52916-16-2 - Introduction
2, a kind of organic compound, chemical formula is C8H14O3.
Its properties are as follows:
1. Appearance: 2. acid is colorless to yellowish crystal.
2. solubility: its solubility is moderate, can be dissolved in water and general organic solvents.
2, the use of acid:
In the field of organic synthesis, 2. acid can be used as intermediates for the synthesis of other organic compounds, such as drugs and pesticides.
preparation method:
2, acid can be obtained by reacting 2,2-dimethyltetrahydro-2H-pyran-4-one with a certain acidic catalyst under appropriate conditions.
Safety Information:
Regarding 2, acid has limited safety information, so it is necessary to follow general laboratory safety procedures when handling and using. Investigators should operate under suitable laboratory conditions and wear appropriate safety equipment, such as lab gloves and goggles. If contact with skin or eyes, rinse immediately with plenty of water and seek medical help. When storing, store 2, acid in a dry, low-temperature place, and store it in isolation from flammable substances and oxidizing agents.
Last Update:2024-04-09 21:54:55