52761-74-7 - Names and Identifiers
Name | 4-(4H-1,2,4-triazol-4-yl)aniline
|
Synonyms | 4-(1,2,4-Triazol-4-yl)aniline 4-(4-AMINOPHENYL)-1,2,4-TRIAZOLE 4-(4H-1,2,4-triazol-4-yl)aniline 4-(p-Aminophenyl)-1,2,4-triazole 4-(4H-1,2,4-Triazol-4-yl)aniline 4-(4H-1,2,4-Triazol-4-yl)benzenamine Benzenamine, 4-(4H-1,2,4-triazol-4-yl)-
|
CAS | 52761-74-7
|
InChI | InChI=1/C8H8N4/c9-7-1-3-8(4-2-7)12-5-10-11-6-12/h1-6H,9H2 |
52761-74-7 - Physico-chemical Properties
Molecular Formula | C8H8N4
|
Molar Mass | 160.18 |
Density | 1.32 |
Melting Point | 195℃ |
Boling Point | 375.3±44.0 °C(Predicted) |
Flash Point | 180.8°C |
Vapor Presure | 7.87E-06mmHg at 25°C |
pKa | 3?+-.0.10(Predicted) |
Refractive Index | 1.689 |
52761-74-7 - Introduction
4-(4H-1,2,4-triazol-4-yl)aniline is an organic compound with the chemical formula C9H8N4. The following is a description of the properties, uses, preparation and safety information of the compound:
1. nature:
-Appearance: 4-(4H-1,2,4-triazol-4-yl)aniline is a white or slightly yellow crystalline powder.
-Melting point: Its melting point is approximately in the range of 211-215°C.
-Solubility: its solubility is small, soluble in some organic solvents such as chloroform, dichloromethane and ethanol.
-Stability: The compound is relatively stable under conventional storage and use conditions.
2. use:
-Medicinal chemistry: 4-(4H-1,2,4-triazol-4-yl)aniline can be used to synthesize biologically active compounds for drug development and pharmaceutical chemistry.
-Pesticide chemistry: It can also be used in the field of pesticides to synthesize pesticides for controlling pests or pathogens.
-Scientific research: The compound can also be used as a reagent in scientific research for the analysis, identification and synthesis of other compounds.
3. Preparation method:
The -4-(4H-1,2,4-triazol-4-yl)aniline can be obtained by a reaction carried out in an organic solvent under a basic condition. Specific synthetic steps may involve different chemical reactions, such as condensation reactions of halogenated aromatic hydrocarbons with 1,2, 4-triazoles, reduction reactions, etc.
4. Safety Information:
- 4-(4H-1,2,4-triazol-4-yl)aniline has no clear toxicity report, but as an organic compound, it should generally follow the safety procedures for general chemicals.
-Wear appropriate personal protective equipment such as lab gloves, safety glasses and lab coats when used.
-Avoid contact with skin, mouth or eyes during use and handling. If you accidentally touch, rinse with plenty of cleaning water immediately and seek medical attention in time.
-Storage should be kept in a dry, cool place, away from fire and open flame.
Last Update:2024-04-09 02:00:46