Name | 5-(4-nitrophenyl)-1,3,4-oxadiazol-2-amine |
Synonyms | 5-(4-nitrophenyl)-1,3,4-oxadiazol-2-amine 1,3,4-Oxadiazol-2-amine, 5-(4-nitrophenyl)- |
CAS | 51891-79-3 |
InChI | InChI=1/C8H6N4O3/c9-8-11-10-7(15-8)5-1-3-6(4-2-5)12(13)14/h1-4H,(H2,9,11) |
Molecular Formula | C8H6N4O3 |
Molar Mass | 206.16 |
Density | 1.493±0.06 g/cm3(Predicted) |
Melting Point | 245-249℃ |
Boling Point | 431.8±47.0 °C(Predicted) |
Flash Point | 214.9°C |
Vapor Presure | 1.17E-07mmHg at 25°C |
pKa | -1.89±0.13(Predicted) |
Sensitive | IRRITANT |
Refractive Index | 1.645 |
MDL | MFCD00603997 |
Hazard Symbols | Xn - Harmful |
Risk Codes | 22 - Harmful if swallowed |
WGK Germany | 3 |
use | 2-amino -5-(4-nitrophenyl)-1,3, 4-oxadiazole can be used as an intermediate in pharmaceutical and chemical synthesis. If 2-amino -5-(4-nitrophenyl)-1,3, 4-oxadiazole is inhaled, please move the patient to fresh air; if skin contact, remove the contaminated clothes, and use soapy water Rinse the skin thoroughly with water and water. If you feel uncomfortable, see a doctor. |