Name | gefarnate |
Synonyms | Arsanate GEFRNATE Gefarnyl gefarnate Gifarnate Geranyl farnesylacetate geranyl 5,9,13-trimethyltetradeca-4,8,12-trienoate [(2E)-3,7-Dimethylocta-2,6-dienyl] (4E,8E)-5,9,13-trimethyltetradeca-4,8,12-trienoate (4E,8E)-5,9,13-Trimethyl-4,8,12-tetradecatrienoic acid (E)-3,7-dimethyl-2,6-octadienyl (2E)-3,7-dimethylocta-2,6-dien-1-yl (4E,8E)-5,9,13-trimethyltetradeca-4,8,12-trienoate 4,8,12-Tetradecatrienoic acid, 5,9,13-trimethyl-, (2E)-3,7-dimethyl-2,6-octadienyl ester, (4E,8E)- |
CAS | 51-77-4 |
EINECS | 200-121-0 |
InChI | InChI=1/C27H44O2/c1-22(2)12-8-14-24(5)16-10-17-25(6)18-11-19-27(28)29-21-20-26(7)15-9-13-23(3)4/h12-13,16,18,20H,8-11,14-15,17,19,21H2,1-7H3/b24-16+,25-18+,26-20+ |
Molecular Formula | C27H44O2 |
Molar Mass | 400.64 |
Density | 1.0044 (rough estimate) |
Melting Point | 25°C |
Boling Point | bp0.05 165-168° |
Flash Point | 93.4°C |
Vapor Presure | 1.5E-09mmHg at 25°C |
Storage Condition | 2-8°C |
Refractive Index | nD20 1.4900 |
In vitro study | Gefarnate (0.001, 0.01, or 0.1 mg/mL) increases mucin-like glycoprotein secretion in a dose-dependent fashion, but the difference from the control is significant only at the concentration of 0.1 mg/mL. Gefarnate specifically stimulates the mucin-like glycoprotein secretion. |