Name | 5-Chloro-1,3-thiazol-2-amine |
Synonyms | 144287 5-Chloro-2-thiazolamine 5-chlorothiazol-2-aMine 2-Amino-5-Chlorothiazole 2-AMINO-5-CHLOROTHIAZOLE 2-thiazolamine, 5-chloro- 2-Thiazolamine, 5-chloro- 5-Chloro-thiazol-2-ylaMine 5-Chloro-1,3-thiazol-2-amine 2-Amino-5-chloro-1,3-thiazole |
CAS | 41663-73-4 |
InChI | InChI=1/C3H3ClN2S/c4-2-1-6-3(5)7-2/h1H,(H2,5,6) |
Molecular Formula | C3H3ClN2S |
Molar Mass | 134.59 |
Density | 1.441 (estimate) |
Melting Point | 109-110 °C |
Boling Point | 260.5±13.0 °C(Predicted) |
Flash Point | 111.3°C |
Vapor Presure | 0.0122mmHg at 25°C |
pKa | 3.22±0.10(Predicted) |
Storage Condition | Room Temprature |
Refractive Index | 1.6100 (estimate) |
category | toxic substances |
toxicity classification | poisoning |
acute toxicity | vein-mouse LD50: 180 mg/kg |
flammability hazard characteristics | combustible; combustion produces toxic nitrogen oxides, sulfur oxides and chloride smoke |
storage and transportation characteristics | warehouse ventilation and low temperature drying |
fire extinguishing agent | dry powder, foam, sand, carbon dioxide, mist water |