| Name | 5-Bromo-quinoline |
| Synonyms | 5-Bromoquinoline RARECHEM AK ML 0010 5-Bromoquinoline,97% |
| CAS | 4964-71-0 |
| InChI | InChI=1/C9H6BrN/c10-8-4-1-5-9-7(8)3-2-6-11-9/h1-6H |
| Molecular Formula | C9H6BrN |
| Molar Mass | 208.055 g/mol |
| Density | 1.564g/cm3 |
| Boling Point | 295.9°C at 760 mmHg |
| Flash Point | 132.8°C |
| Vapor Presure | 0.00261mmHg at 25°C |
| Refractive Index | 1.673 |
| Risk Codes | R36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36 - Wear suitable protective clothing. |