Name | benzothiazol-2-yl 2,4-dinitrophenyl sulphide |
Synonyms | Accelerator DBM 2-[(2,4-Dinitrophenyl)Thio]-Benzothiazole Benzothiazole, 2-((2,4-dinitrophenyl)thio)- Benzothiazol-2-yl 2,4-dinitrophenyl sulphide benzothiazol-2-yl 2,4-dinitrophenyl sulphide |
CAS | 4230-91-5 |
EINECS | 224-183-3 |
InChI | InChI=1/C13H7N3O4S2/c17-15(18)8-5-6-12(10(7-8)16(19)20)22-13-14-9-3-1-2-4-11(9)21-13/h1-7H |
Molecular Formula | C13H7N3O4S2 |
Molar Mass | 333.34 |
Melting Point | 160℃ |
Storage Condition | Room Temprature |
MDL | MFCD00059704 |
Use | Use natural rubber, synthetic rubber accelerator, suitable for the manufacture of rubber shoes, rubber plates, rubber rollers, industrial products, etc. |