Name | 4-phenylmorpholin-3-one |
Synonyms | 4-Phenylmorpholin-3-one 4-Phenyl-3-morpholinone 4-phenylmorpholin-3-one 3-Morpholinone, 4-phenyl- 3-morpholinone, 4-phenyl- |
CAS | 29518-11-4 |
InChI | InChI=1/C10H11NO2/c12-10-8-13-7-6-11(10)9-4-2-1-3-5-9/h1-5H,6-8H2 |
Molecular Formula | C10H11NO2 |
Molar Mass | 177.2 |
Density | 1.187 |
Melting Point | 113-114℃ |
Boling Point | 395.2±35.0 °C(Predicted) |
Flash Point | 192.8°C |
Solubility | Chloroform (Slightly), DMSO (Slightly) |
Vapor Presure | 1.87E-06mmHg at 25°C |
Appearance | Solid |
Color | Off-White |
pKa | 0.27±0.20(Predicted) |
Storage Condition | Sealed in dry,Room Temperature |
Refractive Index | 1.559 |
Use | This product is for scientific research only and shall not be used for other purposes. |
Hazard Class | IRRITANT |
Downstream Products | 1H-ISOINDOLE-1,3(2H)-DIONE, 2-[(2R)-2-HYDROXY-3-[[4-(3-OXO-4-MORPHOLINYL)PHENYL]AMINO]PROPYL]- |