Name | 4-Bromo-2,3-difluoroaniline |
Synonyms | 4-Brom-2,3-difluoranilin 4-BROMO-2,3-DIFLUOROANILINE 4-Bromo-2,3-difluoroaniline Benzenamine, 4-bromo-2,3-difluoro- |
CAS | 112279-72-8 |
InChI | InChI=1/C6H4BrF2N/c7-3-1-2-4(10)6(9)5(3)8/h1-2H,10H2 |
Molecular Formula | C6H4BrF2N |
Molar Mass | 208 |
Density | 1.788±0.06 g/cm3 (20 ºC 760 Torr) |
Boling Point | 215.1±35.0℃ (760 Torr) |
Flash Point | 83.9±25.9℃ |
Vapor Presure | 0.15mmHg at 25°C |
pKa | 1.48±0.10(Predicted) |
Storage Condition | under inert gas (nitrogen or Argon) at 2–8 °C |
Refractive Index | 1.57 |
Application | 4-bromo-2, 3-difluoroaniline is an intermediate in organic synthesis and a pharmaceutical intermediate, can be used in laboratory research and development process and chemical production process. |