4,5-dimethyl-1,2-dihydropyridazine-3,6-dione - Names and Identifiers
Name | 4,5-dimethyl-1,2-dihydropyridazine-3,6-dione
|
Synonyms | diMethylpyridazine-3,6-diol 4,5-Dimethylpyridazine-3,6-diol 3,6-Dihydroxy-4,5-Dimethylpyridazine 3,6-Dihydroxy-4,5-dimethylpyridazine 1,2-Dihydro-4,5-dimethyl-3,6-pyridazinedione 4,5-dimethyl-1,2-dihydropyridazine-3,6-dione Dimethylmaleic acid dimethyl cyclic hydrazide 4,5-dimethyl-1,2-dihydropyridazine-3,6-quinone 3,6-DIHYDROXY-4,5-DIMETHYLPYRIDAZINE (4,5-DIMETHYLMALEIC HYDRAZIDE)
|
CAS | 5754-17-6
|
EINECS | 1312995-182-4 |
InChI | InChI=1/C6H8N2O2/c1-3-4(2)6(10)8-7-5(3)9/h1-2H3,(H,7,9)(H,8,10) |
4,5-dimethyl-1,2-dihydropyridazine-3,6-dione - Physico-chemical Properties
Molecular Formula | C6H8N2O2
|
Molar Mass | 140.14 |
Density | 1.160±0.06 g/cm3(Predicted) |
Melting Point | 347-351 °C |
Boling Point | 422.4°C at 760 mmHg |
Flash Point | 209.3°C |
Vapor Presure | 9.83E-08mmHg at 25°C |
pKa | 9.08±0.60(Predicted) |
Storage Condition | Inert atmosphere,Room Temperature |
Refractive Index | 1.481 |
4,5-dimethyl-1,2-dihydropyridazine-3,6-dione - Risk and Safety
Hazard Symbols | T - Toxic
|
Hazard Note | Toxic |
4,5-dimethyl-1,2-dihydropyridazine-3,6-dione - Introduction
4,5-dimethyl-1,2-dihydropyridazine-3,6-dione is an organic compound with the chemical formula C6H8N2O4. It has the following properties:
1. Appearance: colorless crystalline or white powdery solid.
2. melting point: about 255-260 degrees Celsius.
3. Solubility: Soluble in hot organic solvents, such as alcohol and ether, insoluble in water.
4. Stability: Stable at room temperature, but may decompose under strong acidic conditions.
4,5-dimethyl-1,2-dihydropyridazine-3,6-dione has many uses in chemical research:
1. as an intermediate of basic dyes, used in the synthesis of dyes and pigments.
2. used as a redox reaction catalyst, participate in organic synthesis reaction.
3. As part of the skeleton structure in drug synthesis.
The method of preparing 4,5-dimethyl-1,2-dihydropyridazine-3,6-dione is generally carried out through the following steps:
1. Esterification of 2,5-dimethyl -3,6-dihydroxy pyridazine with an appropriate acid.
2. An ester hydrolysis reaction is carried out under alkaline conditions to obtain the target product.
Regarding safety information, 4,5-dimethyl-1,2-dihydropyridazine-3,6-dione is relatively stable under normal use conditions, but the following matters should be noted:
1. Avoid contact with strong oxidants and strong acids to prevent dangerous reactions.
2. Wear personal protective equipment such as glasses, gloves and lab coats when operating.
3. Maintain good ventilation during use and avoid inhaling dust or gas.
4. In case of contact with skin or eyes, rinse immediately with plenty of water and seek medical attention.
Last Update:2024-04-09 20:02:46