4,4'-hex-2-yne-1,6-diyldimorpholine - Names and Identifiers
Name | 4,4'-hex-2-yne-1,6-diyldimorpholine
|
Synonyms | 4,4'-hex-2-yne-1,6-diyldimorpholine 4,4'-(hex-2-yne-1,6-diyl)dimorpholine 4-(6-morpholin-4-ylhex-2-ynyl)morpholine
|
CAS | 7252-90-6
|
InChI | InChI=1/C14H24N2O2/c1(3-5-15-7-11-17-12-8-15)2-4-6-16-9-13-18-14-10-16/h1,3,5-14H2 |
4,4'-hex-2-yne-1,6-diyldimorpholine - Physico-chemical Properties
Molecular Formula | C14H24N2O2
|
Molar Mass | 252.35 |
Density | 1.051g/cm3 |
Boling Point | 375.2°C at 760 mmHg |
Flash Point | 110.4°C |
Vapor Presure | 7.92E-06mmHg at 25°C |
Refractive Index | 1.504 |
4,4'-hex-2-yne-1,6-diyldimorpholine - Introduction
4,4 '-hex-2-yne-1,6-diyldimorpholine(4,4'-hex-2-yne-1,6-diyldimorpholine) is an organic compound with the following properties:
1. Appearance: White crystalline solid.
2. molecular formula: C14H22N2O2.
3. Molecular weight: 250.34g/mol.
4. Solubility: Soluble in organic solvents such as ethanol and dichloromethane.
5. melting point: about 80-82 ℃.
4,4 '-hex-2-yne-1,6-diyldimorpholine has a number of commercial and industrial uses, including:
1. As an antioxidant: it can be used as a stabilizer and antioxidant for materials such as rubber, plastic and synthetic fiber.
2. As a cross-chain agent: it can react with polymers to form a three-dimensional network structure and improve the mechanical strength and thermal stability of the material.
3. as an adhesive: can be used to bond various materials, such as metal, rubber, plastic, etc.
4,4 '-hex-2-yne-1,6-diyldimorpholine can be prepared by the following methods:
The reaction of 2-hexydone with type 2 morpholine under alkaline conditions produces 4,4 '-hex-2-yne-1,6-diyldimorpholine.
Regarding safety information, 4,4 '-hex-2-yne-1,6-diyldimorpholine has low toxicity, but the following matters still need to be noted:
1. Avoid direct contact with skin, eyes and respiratory tract. Wear appropriate personal protective equipment such as gloves, goggles and masks when working.
2. avoid inhalation of its dust or solution vapor, so as not to cause respiratory discomfort.
3. storage should be away from fire and high temperature, avoid exposure to direct sunlight.
In general, 4,4 '-hex-2-yne-1,6-diyldimorpholine is an organic compound widely used in the chemical industry. It has the functions of stabilizer, cross chain agent and adhesive, but safety measures should be paid attention to when using.
Last Update:2024-04-10 22:29:15