Name | 4'-chloro-2'-methylacetoacetanilide |
Synonyms | 4-CHLORO-2-ACETOACETOLUIDIDE 4-CHLORO-O-ACETOACETOTOLUIDIDE ACETOACET-P-CHLORO-O-TOLUIDIDE N-Acetoaceto-P-Chloro-O-Toluidide Acetoacet-4-chloro-2-methylanilide 4'-chloro-2'-methylacetoacetanilide 4'-Chloro-2'-methylacetoacetanilide 4-Chloro-2-Methyl-N-Acetoacet Anilide Acetoacet-P-Chloro-O-Toluidide(Aapcot) N-(4-chloro-2-methylphenyl)-3-oxobutanamide N-(4-Chloro-2-methyl-phenyl)-3-oxo-butanamide |
CAS | 20139-55-3 |
EINECS | 243-540-4 |
InChI | InChI=1/C11H12ClNO2/c1-7-5-9(12)3-4-10(7)13-11(15)6-8(2)14/h3-5H,6H2,1-2H3,(H,13,15) |
Molecular Formula | C11H12ClNO2 |
Molar Mass | 225.67 |
Density | 1.2076 (rough estimate) |
Melting Point | 103 °C |
Boling Point | 174°C (rough estimate) |
Flash Point | 189.9°C |
Vapor Presure | 2.66E-06mmHg at 25°C |
pKa | 11.00±0.46(Predicted) |
Storage Condition | Room Temprature |
Refractive Index | 1.5500 (estimate) |
MDL | MFCD00018493 |
RTECS | AK4599000 |
Toxicity | LD50 orl-rat: 3500 mg/kg LONZA# 22SEP81 |
use | mainly used for synthetic dyes and pigments |
category | toxic substances |
toxicity classification | poisoning |
acute toxicity | oral-rat LD50: 3500 mg/kg |
flammability hazard characteristics | combustible; combustion produces toxic nitrogen oxides and chloride smoke |
storage and transportation characteristics | warehouse ventilation and low temperature drying |
fire extinguishing agent | dry powder, foam, sand, water |
EPA chemical information | Information provided by: ofmpub.epa.gov (external link) |