Name | 2,6-diphenylcyclohexanone, mixture of cis an |
Synonyms | 2,6-DIPHENYLCYCLOHEXANONE Cyclohexanone, 2,6-diphenyl- 2,6-diphenylcyclohexanone, mixture of cis an 2,6-Diphenylcyclohexanone,mixture of cis and trans |
CAS | 37904-84-0 |
InChI | InChI=1/C18H18O/c19-18-16(14-8-3-1-4-9-14)12-7-13-17(18)15-10-5-2-6-11-15/h1-6,8-11,16-17H,7,12-13H2 |
Molecular Formula | C18H18O |
Molar Mass | 250.33 |
Density | 1.082±0.06 g/cm3(Predicted) |
Melting Point | 119-121°C(lit.) |
Boling Point | 405.3±45.0 °C(Predicted) |
Flash Point | 177.4°C |
Vapor Presure | 8.85E-07mmHg at 25°C |
Refractive Index | 1.577 |
WGK Germany | 3 |