Name | p-[2-(methylamino)ethyl]phenol |
Synonyms | n-methyl-tyramin N-Methyltyramine methyl-4-tyramine N-METHYL-P-TYRAMINE p-(2-methylaminoethyl)phenol p-(2-methylaminoethyl)-pheno 4-(2-methylaminoethyl)phenol p-(2-Methylaminoethyl)phenol 4-(2-METHYLAMINO-ETHYL)-PHENOL p-[2-(methylamino)ethyl]phenol 4-Hydroxy-N-methylphenethylamine 4-HYDROXY-N-METHYLPHENETHYLAMINE N-Methyl-4-hydroxyphenylethylamine 2-(4-hydroxyphenyl)ethyl-methylammonium |
CAS | 370-98-9 |
EINECS | 206-731-3 |
InChI | InChI=1/C9H13NO.ClH/c1-10-7-6-8-2-4-9(11)5-3-8;/h2-5,10-11H,6-7H2,1H3;1H |
Molecular Formula | C9H13NO |
Molar Mass | 151.21 |
Density | 1.035±0.06 g/cm3(Predicted) |
Melting Point | 130~131℃ |
Boling Point | 270.9±15.0 °C(Predicted) |
Flash Point | 119.7°C |
Solubility | DMSO (Slightly), Methanol (Slightly) |
Vapor Presure | 0.004mmHg at 25°C |
Appearance | Solid |
Color | Pale Beige to Light Beige |
pKa | 9.86±0.15(Predicted) |
Storage Condition | Refrigerator |
Physical and Chemical Properties | White Prism Crystal (ethanol), Flake Crystal (benzene), melting point 130~131 ℃, boiling point 183~185 ℃(1.20kPa) slightly soluble in water. Hydrochloride is white flake or needle-like crystal (ethanol-ether), melting point 149~150.5 ℃. Yellow to off-white crystalline or crystalline powder |