35100-92-6 - Names and Identifiers
Name | 3-Amino-1,5-dimethylpyrazole
|
Synonyms | 1,5-dimethylpyrazol-3-amine 1,5-dimethyl-3-pyrazolamine 3-Amino-1,5-dimethylpyrazole 3-AMINO-1,5-DIMETHYLPYRAZOLE (1,5-dimethylpyrazol-3-yl)amine 1,5-dimethyl-1H-pyrazol-3-amine 3-Amino-1,5-dimethyl-1H-pyrazole 1,5-Dimethyl-1H-pyrazol-3-ylamine 1,5-Dimethyl-1H-Pyrazol-3-Ylamine(WX609107)
|
CAS | 35100-92-6
|
InChI | InChI=1/C5H9N3/c1-4-3-5(6)7-8(4)2/h3H,1-2H3,(H2,6,7) |
35100-92-6 - Physico-chemical Properties
Molecular Formula | C5H9N3
|
Molar Mass | 111.15 |
Density | 1.17 |
Melting Point | 65-68 ºC |
Boling Point | 235 ºC |
Flash Point | 96 ºC |
Vapor Presure | 0.0521mmHg at 25°C |
pKa | 4.17±0.11(Predicted) |
Storage Condition | 2-8°C(protect from light) |
Refractive Index | 1.581 |
35100-92-6 - Risk and Safety
Risk Codes | 20/21/22 - Harmful by inhalation, in contact with skin and if swallowed.
|
Safety Description | S3/9 -
S36/37 - Wear suitable protective clothing and gloves.
|
HS Code | 29331990 |
Hazard Class | IRRITANT |
35100-92-6 - Introduction
3-Amino-1,5-dimethylpyrazole is an organic compound with the chemical formula C5H8N2. It is a colorless crystal or powder with a special nitrogen heterocyclic structure. The following is a detailed description of the nature, use, preparation and safety information of 3-Amino-1, 5-dimenthylpyrazole:
Nature:
1. Appearance: colorless crystal or powder.
2. Solubility: Soluble in some organic solvents, such as ethanol, chloroform, etc.
3. melting point: about 166-169 degrees Celsius.
4. Boiling point: about 311 degrees Celsius.
5. specific gravity: about 1.07-1.1.
Use:
1. 3-Amino-1,5-dimethylpyrazole is an important intermediate compound, which is commonly used in organic synthesis and drug synthesis.
2. It can be used as a raw material for organic dyes, light stabilizers, antibacterial agents, etc.
Preparation Method:
3-Amino-1,5-dimethylpyrazole can be synthesized:
1.2,4-dimethylpyridine is reacted with malonic anhydride to obtain 2,4-dimethyl -3-aminopyridine, which is then dehydrated to form 3-Amino-1,5-dimethylpyrazole.
2.2,4-dimethyl -3-formyl pyridine is prepared by the reaction of 2,4-lutidine and formyl chloride, and 3-Amino-1,5-dimethylpyrazole is prepared by decarbonylation.
Safety Information:
1. 3-Amino-1,5-dimethylpyrazole is relatively stable at room temperature, but contact with open flames and high temperature conditions should be avoided.
2. When handling the compound, wear appropriate protective gloves and glasses to avoid skin and eye contact.
3. When using in the laboratory, follow the correct operating procedures and operate in a well-ventilated place.
4. 3-Amino-1,5-dimethylpyrazole should be stored in a sealed, dry and cool place, away from oxidants and fire sources.
Last Update:2024-04-09 02:00:45