Name | isostearic acid |
Synonyms | isostearic isostearic acid ISOSTEARIC ACID ISOOCTADECANOIC ACID Isooctadecanoic acid 16-methyl-heptadecanoicaci 16-methylheptadecanoic acid 16-METHYLHEPTADECANOIC ACID ISOSTEARIC ACID MIXED ISOMERS Heptadedecanoicacid,16-Methyl Heptadecanoic acid, 16-methyl- |
CAS | 2724-58-5 30399-84-9 |
EINECS | 220-336-3 |
InChI | InChI=1/C18H36O2/c1-17(2)15-13-11-9-7-5-3-4-6-8-10-12-14-16-18(19)20/h17H,3-16H2,1-2H3,(H,19,20) |
Molecular Formula | C18H36O2 |
Molar Mass | 284.48 |
Density | 0.89g/mLat 25°C(lit.) |
Melting Point | 67.8-68.5 °C |
Boling Point | 369.53°C (estimate) |
Flash Point | 225.6°C |
Vapor Presure | 1.52E-07mmHg at 25°C |
Appearance | Liquid |
pKa | 4.78±0.10(Predicted) |
Storage Condition | 2-8°C |
Stability | Stable. Combustible. Incompatible with bases, strong oxidizing agents. |
Refractive Index | 1.4440 (estimate) |
Use | Used as raw materials for cosmetics, high-grade lubricating oil additives, various esters of raw materials |
WGK Germany | 3 |
RTECS | MI3875000 |