Name | 3-phenylthiophene |
Synonyms | Phenylthiophene 3-phenylthiophene 3-PHENYLTHIOPHENE Thiophene, 3-phenyl- N-[9-chloro-2-(2-furanyl)-[1,2,4]triazolo[1,5-c]quinazolin-5-yl]-2-phenylacetamide |
CAS | 2404-87-7 |
EINECS | 219-297-5 |
InChI | InChI=1/C10H8S/c1-2-4-9(5-3-1)10-6-7-11-8-10/h1-8H |
Molecular Formula | C10H8S |
Molar Mass | 160.24 |
Density | 1.111g/cm3 |
Melting Point | 90-93 °C (lit.) |
Boling Point | 256 °C |
Flash Point | 65.5°C |
Vapor Presure | 0.11mmHg at 25°C |
Appearance | powder to crystal |
Color | White to Almost white |
Storage Condition | 2-8°C |
Refractive Index | 1.598 |
MDL | MFCD00114997 |
WGK Germany | 3 |
use | conductive polymer precursor. |