Name | 3-(4-fluorophenyl)-1-phenyl-1H-pyrazole-4-carbaldehyde |
Synonyms | 189214 3-(4-Fluorophenyl)-1-phenylpyrazole-4-carbaldehyde 3-(4-fluorophenyl)-1-phenyl-1H-pyrazole-4-carbaldehyde 1H-Pyrazole-4-carboxaldehyde, 3-(4-fluorophenyl)-1-phenyl- |
CAS | 36640-40-1 |
InChI | InChI=1/C16H11FN2O/c17-14-8-6-12(7-9-14)16-13(11-20)10-19(18-16)15-4-2-1-3-5-15/h1-11H |
Molecular Formula | C16H11FN2O |
Molar Mass | 266.27 |
Density | 1.2g/cm3 |
Melting Point | 158~160℃ |
Boling Point | 439.3°C at 760 mmHg |
Flash Point | 219.5°C |
Vapor Presure | 6.43E-08mmHg at 25°C |
Storage Condition | 2-8℃ |
Refractive Index | 1.609 |
Use | This product is for scientific research only and shall not be used for other purposes. |