Name | 3,3'-dimethylbiphenyl |
Synonyms | 612-75-9 3,3'-Ditolyl 3,3'-ditolyl M,M'-BITOLUENE 3,3'-dimethylbiphenyl 3,3'-Dimethylbiphenyl 3,3'-Dimethyl-1,1'-biphenyl 3,3'-dimethyl-1,1'-biphenyl 1,1'-Biphenyl, 3,3'-dimethyl- 1-methyl-3-(3-methylphenyl)benzene 1-Methyl-3-(3'-methylphenyl)benzene |
CAS | 612-75-9 |
EINECS | 210-319-9 |
InChI | InChI=1/C14H14/c1-11-5-3-7-13(9-11)14-8-4-6-12(2)10-14/h3-10H,1-2H3 |
Molecular Formula | C14H14 |
Molar Mass | 182.26 |
Density | 0.999g/mLat 25°C(lit.) |
Melting Point | 5-7°C(lit.) |
Boling Point | 286°C713mm Hg(lit.) |
Flash Point | >230°F |
Vapor Presure | 0.00684mmHg at 25°C |
Appearance | clear liquid |
Color | Colorless to Amber to Dark green |
Storage Condition | Sealed in dry,Room Temperature |
Refractive Index | n20/D 1.594(lit.) |
MDL | MFCD00008534 |
WGK Germany | 3 |
HS Code | 29029090 |