| Name | 1-Benzylpiperidine |
| Synonyms | N-benzylpiperidine 1-benzylpiperidine hydrochloride (1:1) |
| CAS | 2905-56-8 |
| EINECS | 220-809-4 |
| InChI | InChI=1/C12H17N.ClH/c1-3-7-12(8-4-1)11-13-9-5-2-6-10-13;/h1,3-4,7-8H,2,5-6,9-11H2;1H |
| Molecular Formula | C12H18ClN |
| Molar Mass | 211.731 |
| Boling Point | 246.6°C at 760 mmHg |
| Flash Point | 94°C |
| Vapor Presure | 0.0269mmHg at 25°C |
| Risk Codes | R36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36 - Wear suitable protective clothing. |