Name | Hexanedioic acid, polymer with 1,2-Propanediol |
Synonyms | Hexanedioic acid, po Poly(propylene adipate) Poly(propylene glycol adipate) Poly(1,2-propylene glycol adipate) Propylene glycol, adipic acid resin Hexanedioic acid, polymer with 1,2-propanediol Hexanedioic acid, polymer with 1,2-Propanediol |
CAS | 25101-03-5 |
InChI | InChI=1/C6H10O4.C3H8O2/c7-5(8)3-1-2-4-6(9)10;1-3(5)2-4/h1-4H2,(H,7,8)(H,9,10);3-5H,2H2,1H3 |
Molecular Formula | C9H18O6 |
Molar Mass | 222.23562 |
Boling Point | 338.5°C at 760 mmHg |
Flash Point | 172.7°C |
Vapor Presure | 1.81E-05mmHg at 25°C |
Use | Mainly used for the production of anti-corrosion polyurethane coatings, adhesives, polyurethane rubber tires |