Name | 2,6-Dibromopyrazine |
Synonyms | 2,6-Dibromopyrazine Pyrazine, 2,6-dibromo- pyrazine, 2,6-dibromo- |
CAS | 23229-25-6 |
InChI | InChI=1/C4H2Br2N2/c5-3-1-7-2-4(6)8-3/h1-2H |
Molecular Formula | C4H2Br2N2 |
Molar Mass | 237.88 |
Density | 2?+-.0.06 g/cm3(Predicted) |
Melting Point | 51.0 to 55.0 °C |
Boling Point | 65°C/1.5mmHg(lit.) |
Flash Point | 95.1°C |
Water Solubility | Slightly soluble in water. |
Vapor Presure | 0.0844mmHg at 25°C |
Appearance | Crystalline Solid |
Color | Off-white to pale brown |
pKa | -3.21±0.10(Predicted) |
Storage Condition | Inert atmosphere,Store in freezer, under -20°C |
Refractive Index | 1.615 |
MDL | MFCD08061601 |