Name | 1H-indol-3-ylmethylamine |
Synonyms | RARECHEM AL BW 0382 3-(AMINOMETHYL)INDOLE 1H-Indole-3-methanamine 1H-INDOL-3-YLMETHYLAMINE 1H-indol-3-ylmethylamine 3-Methyl-1H-indol-1-amine (1H-INDOL-3-YL)METHANAMINE (1H-Indol-3-Yl)Methanamine 1-(1H-Indol-3-yl)methanamine 1-(1H-indol-3-yl)methanamine |
CAS | 22259-53-6 |
InChI | InChI=1/C9H10N2/c10-5-7-6-11-9-4-2-1-3-8(7)9/h1-4,6,11H,5,10H2 |
Molecular Formula | C9H10N2 |
Molar Mass | 146.19 |
Density | 1.199 |
Melting Point | 101-102℃ |
Boling Point | 336℃ |
Flash Point | 183℃ |
Vapor Presure | 0.000118mmHg at 25°C |
pKa | 17.13±0.30(Predicted) |
Storage Condition | 2-8°C(protect from light) |
Refractive Index | 1.697 |
Hazard Symbols | Xi - Irritant |
UN IDs | UN2811 |
Hazard Class | IRRITANT |
biological activity | Indole-3-methanamine are biomarkers of barley and cereal intake. |