157911-55-2 - Names and Identifiers
Name | 2,3,4-trifluorobenzyl bromide
|
Synonyms | 2,3,4-trifluorobenzyl bromide 2,3,4-TRIFLUOROBENZYL BROMIDE à-bromo-2,3,4-trifluorotoluene alpha-Bromo-2,3,4-trifluorotoluene ALPHA-BROMO-2,3,4-TRIFLUOROTOLUENE 1-(bromomethyl)-2,3,4-trifluorobenzene 6-(BROMOMETHYL)-1,2,3-TRIFLUOROBENZENE Benzene, 1-(bromomethyl)-2,3,4-trifluoro-
|
CAS | 157911-55-2
|
EINECS | 624-279-9 |
InChI | InChI=1/C7H4BrF3/c8-3-4-1-2-5(9)7(11)6(4)10/h1-2H,3H2 |
157911-55-2 - Physico-chemical Properties
Molecular Formula | C7H4BrF3
|
Molar Mass | 225.01 |
Density | 1.710g/mLat 25°C(lit.) |
Boling Point | 191.4±35.0 °C(Predicted) |
Flash Point | 195°F |
Vapor Presure | 0.718mmHg at 25°C |
Appearance | Liquid |
Color | Clear colorless to pale yellow |
BRN | 8762822 |
Storage Condition | Inert atmosphere,2-8°C |
Sensitive | Lachrymatory |
Refractive Index | n20/D 1.5070(lit.) |
157911-55-2 - Risk and Safety
Hazard Symbols | C - Corrosive
|
Risk Codes | 34 - Causes burns
|
Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.
S27 - Take off immediately all contaminated clothing.
S36/37/39 - Wear suitable protective clothing, gloves and eye/face protection.
S45 - In case of accident or if you feel unwell, seek medical advice immediately (show the label whenever possible.)
|
UN IDs | UN 3265 8/PG 2 |
WGK Germany | 3 |
TSCA | T |
HS Code | 29039990 |
Hazard Note | Corrosive/Lachrymatory |
Hazard Class | 8 |
Packing Group | II |
157911-55-2 - Introduction
2,3,4-trifluorobenzyl bromide is an organic compound with the formula C7H3BrF3. Its nature is as follows:
1. Appearance: 2,3,4-trifluorobenzyl bromide is a colorless to pale yellow liquid.
2. Melting point and boiling point: its melting point is -37.9 ℃, boiling point is 194.5 ℃.
3. Solubility: It has good solubility in common organic solvents, such as ethanol, benzene and ether.
4. Chemical properties: 2,3,4-trifluorobenzyl bromide shows good activity in some chemical reactions, such as it can react with electrophilic reagents such as nitrosamide.
In practical applications, 2,3,4-trifluorobenzyl bromide has the following uses:
1. Pesticide: It can be used as an intermediate for the preparation of pesticides and fungicides.
2. Drug: 2,3,4-trifluorobenzyl bromide is an important raw material for the manufacture of drugs.
3. Synthetic chemistry: as an important reagent in organic synthesis, it can participate in a variety of organic synthesis reactions.
The method of preparing 2,3,4-trifluorobenzyl bromide mainly includes the following steps:
1. Dissolve benzyl bromide in an organic solvent.
2. Adding polynuclear copper salts as catalyst.
3. Hydrogen fluoride gas is introduced into the reaction system.
4. The reaction is carried out at an appropriate temperature and reaction time.
Safety Information:
When dealing with 2,3,4-trifluorobenzyl bromide, you need to pay attention to the following safety precautions:
1. Avoid contact with skin and eyes to prevent irritation and corrosion.
2. Use appropriate personal protective equipment, such as protective gloves and goggles, during operation.
3. Avoid inhaling its gas or vapor and ensure that it is operated in a well-ventilated place.
4. It is strictly prohibited to contact with oxidants and strong acids to avoid dangerous reactions.
5. Avoid contact with flammable and combustible materials during storage and handling to prevent fire and explosion.
Before using or operating 2,3,4-trifluorobenzyl bromide, make sure to understand its safe operating procedures and follow relevant regulations and guidelines.
Last Update:2024-04-09 19:05:46