Name | 2-(4,ALPHA-DICHLOROBENZYL)PYRIDINE |
Synonyms | Ccris 5988 CCRIS 5988 2-(4,alpha-Dichlorobenzyl)pyridine 2-(4,ALPHA-DICHLOROBENZYL)PYRIDINE 2-(Chloro(4-chlorophenyl)methyl)pyridin 2-[Chloro(4-chlorophenyl)methyl]pyridine 2-[chloro(4-chlorophenyl)methyl]pyridine Pyridine, 2-[chloro(4-chlorophenyl)Methyl]- |
CAS | 142404-69-1 |
EINECS | 1312995-182-4 |
InChI | InChI=1/C12H9Cl2N/c13-10-6-4-9(5-7-10)12(14)11-3-1-2-8-15-11/h1-8,12H |
Molecular Formula | C12H9Cl2N |
Molar Mass | 238.11 |
Density | 1.279 |
Boling Point | 338.7±32.0 °C(Predicted) |
Flash Point | 189.141°C |
Vapor Presure | 0mmHg at 25°C |
pKa | 4.22±0.10(Predicted) |
Storage Condition | under inert gas (nitrogen or Argon) at 2-8°C |
Refractive Index | 1.597 |
Use | This product is for scientific research only and shall not be used for other purposes. |