129012-04-0 - Names and Identifiers
Name | 6-bromopyridine-2,3-diamine
|
Synonyms | 6-broMopyridin-2,3-diaMine 2,3-DiaMino-6-broMopyridine 6-Bromo-2,3-diaminopyridine 6-bromopyridine-2,3-diamine 6-BROMOPYRIDINE-2,3-DIAMINE 6-Bromo-2,3-pyridinediamine 2,3-Pyridinediamine, 6-bromo-
|
CAS | 129012-04-0
|
InChI | InChI=1/C5H6BrN3/c6-4-2-1-3(7)5(8)9-4/h1-2H,7H2,(H2,8,9) |
129012-04-0 - Physico-chemical Properties
Molecular Formula | C5H6BrN3
|
Molar Mass | 188.03 |
Density | 1.818 |
Boling Point | 345.2±37.0 °C(Predicted) |
Flash Point | 162.576°C |
Vapor Presure | 0mmHg at 25°C |
pKa | 2.65±0.50(Predicted) |
Storage Condition | under inert gas (nitrogen or Argon) at 2–8 °C |
Refractive Index | 1.712 |
129012-04-0 - Introduction
2,3-diamino-6-bromopyridine is an organic compound with the chemical formula of C5H7BrN2. Structurally, the 2 and 3 positions of the pyridine ring are substituted by amino groups, and a bromine atom is substituted at the 6 position.
Properties of the compound include:
1. Appearance: white or colorless crystal
2. melting point: about 130-133 ℃
3. solubility: soluble in alcohol, ether and ketone, slightly soluble in water.
2,3-Diamino-6-bromopyridine has a number of important uses in chemistry and medicine, including:
1. It is an important intermediate and can be used to synthesize other compounds, such as drugs, dyes, enzyme inhibitors, etc.
2. In the pharmaceutical industry, it can be used to synthesize antibiotics, anticancer drugs, immunosuppressants and other drugs.
2,3-diamino-6-bromopyridine has several preparation methods:
1. nitration method: through the substitution reaction synthesis, first pyridine and nitric acid reaction to generate nitro pyridine, and then use sodium nitrite reduction, and finally under alkaline conditions to add bromine water reaction to generate the target product.
2. bromination method: pyridine is reacted with bromine to generate 2,3-dibromopyridine, and then reduced to generate 2,3-diamino -6-bromopyridine.
For safety information, since 2,3-diamino-6-bromopyridine is widely used in the laboratory, the following matters need to be paid attention:
1. The compound is a flammable solid and should avoid exposure to open flames and high temperatures.
2. in the process of operation, the need to do a good job of safety protection measures, including wearing chemical protective glasses, gloves and laboratory coats.
3. avoid inhalation of gas, dust and steam, should be in a well ventilated place to operate.
4. In case of contact with skin or eyes, rinse immediately with plenty of water and seek medical assistance.
5. Strictly abide by the laboratory safety operation specifications to ensure the safety of the operating environment.
Last Update:2024-04-09 19:05:46