107807-39-6 - Names and Identifiers
Name | 2,3-Dihydro-6-isothiocyanato-1,4-phthalazinedione
|
Synonyms | Isoluminol isothiocyanate 4-ISOLUMINOL ISOTHIOCYANATE 4-ISOTHIOCYANATOPHTHALHYDRAZIDE Dihydroisothiocyanatophtalazinedione [HPLC Labeling Reagent for CheMiluMinescent] 2,3-Dihydro-6-isothiocyanato-1,4-phtalazinedione 2,3-Dihydro-6-isothiocyanato-1,4-phthalazinedione 6-isothiocyanato-2,3-dihydrophthalazine-1,4-dione 4-Isoluminol Isothiocyanate4-Isothiocyanatophthalhydrazide 2,3-DIHYDRO-6-ISOTHIOCYANATO-1,4-PHTHALAZINEDIONE [HPLC LABELING REAGENT FOR CHEMILUMINESCENT]
|
CAS | 107807-39-6
|
InChI | InChI=1/C9H5N3O2S/c13-8-6-2-1-5(10-4-15)3-7(6)9(14)12-11-8/h1-3H,(H,11,13)(H,12,14) |
107807-39-6 - Physico-chemical Properties
Molecular Formula | C9H5N3O2S
|
Molar Mass | 219.22 |
Density | 1.59±0.1 g/cm3(Predicted) |
Melting Point | 41 °C |
pKa | 9.91±0.20(Predicted) |
Storage Condition | Refrigerator |
Refractive Index | 1.767 |
MDL | MFCD00191641 |
107807-39-6 - Risk and Safety
Safety Description | 24/25 - Avoid contact with skin and eyes.
|
HS Code | 29339900 |
107807-39-6 - Introduction
2,3-dihydro -6-isothiocyano-1, 4-phthalazinedione (also known as phospho-threonamide, DTP for short) is an organic compound. Its molecular formula is C8H6N2O2S, and its structure contains 1,4-diketone and isothiocyanate (NCS).
Nature of DTP:
1. appearance: white crystal powder.
2. solubility: soluble in some organic solvents, such as ethanol and ethyl acetate.
3. melting point: about 170-172 ℃.
Purpose of DTP:
1. Chemical reagent: DTP is often used as a reagent for organic synthesis, such as amine modification and active hydrogen protection.
2. chemical raw materials: DTP can be used as a synthetic intermediate for some dyes and fluorescent substances.
3. Drug: DTP and its derivatives have certain biological activity and have certain application prospects in drug research.
Preparation Method:
there are many preparation methods of DTP, one of the commonly used methods is obtained by the reaction of 1,4-phthalazine dione and ammonium isothiocyanate:
1. Add 1,4-phthalazinedione and ammonium isothiocyanate to the reaction flask.
2. the reaction flask is heated to generate the product DTP.
3. Further processing, crystallization, drying and other steps to obtain pure 2,3-dihydro -6-isothiocyanate -1,4-phthalazine dione.
Safety Information:
1. DTP is irritating and can cause irritation and discomfort after contact with skin and eyes. Attention should be paid to avoid direct contact.
2. When using DTP, personal protective equipment such as protective gloves, glasses and protective clothing should be worn to ensure safe operation.
3. DTP decomposes at high temperature to release toxic gases, so you should pay attention to the ventilation environment or take other effective ventilation measures during operation.
4. DTP is an organic synthetic reagent, which may have a certain impact on human health and the environment. When used, it should follow the requirements of relevant laws and regulations, and properly dispose of waste.
Last Update:2024-04-09 20:44:15