Name | 1-(4-Bromophenyl)piperazine |
Synonyms | KML-30 CML-027 1-(4-Bromophenyl)piperazine 1-(4-BROMOPHENYL)PIPERAZINE Piperazine, 1-(4-bromophenyl)- 1-(4-BROMO-PHENYL)-PIPERAZINE DIHYDROCHLORIDE |
CAS | 66698-28-0 |
InChI | InChI=1/C10H13BrN2/c11-9-1-3-10(4-2-9)13-7-5-12-6-8-13/h1-4,12H,5-8H2 |
Molecular Formula | C10H13BrN2 |
Molar Mass | 241.13 |
Density | 1.386±0.06 g/cm3(Predicted) |
Melting Point | 91-95 °C |
Boling Point | 353.3±27.0 °C(Predicted) |
Flash Point | 167.5°C |
Vapor Presure | 3.62E-05mmHg at 25°C |
pKa | 8.88±0.10(Predicted) |
Storage Condition | 2-8°C |
Refractive Index | 1.575 |
Risk Codes | 20/21/22 - Harmful by inhalation, in contact with skin and if swallowed. |
WGK Germany | 1 |
Hazard Note | Irritant |