1,1''-isopropylidenediferrocene - Names and Identifiers
Name | 1,1''-isopropylidenediferrocene
|
Synonyms | 1,1''-Isopropylidenediferrocene 1,1''-isopropylidenediferrocene
|
CAS | 12609-95-9
|
EINECS | 235-719-0 |
InChI | InChI=1/C13H14.2C5H5.2Fe/c1-11(13-8-4-5-9-13)10-12-6-2-3-7-12;2*1-2-4-5-3-1;;/h2-9,11H,10H2,1H3;2*1-5H;;/q-2;2*-1;2*+2 |
1,1''-isopropylidenediferrocene - Physico-chemical Properties
Molecular Formula | C23H24Fe2
|
Molar Mass | 412.12666 |
Boling Point | 260°C at 760 mmHg |
Flash Point | 92.5°C |
Vapor Presure | 0.0203mmHg at 25°C |
1,1''-isopropylidenediferrocene - Introduction
2,2-diferrocene propane, also known as diferrocene, is an organometallic compound. Its chemical formula is (C10H10Fe)2. In the structure, two ferrocene molecules are linked together by a propane bridge.
2,2-bis-ferrocene propane has the following properties:
1. Appearance: 2,2-diferrocene propane is a solid, yellow to orange crystal.
2. Melting point: Its melting point is about 165-167°C.
3. Solubility: 2,2-diferrocene propane is soluble in organic solvents such as ethanol, dimethylformamide, etc.
the use of 2,2-diferrocene propane:
1. Electrocatalyst: Due to the good electron transport properties of diferrocene, it is widely used in various electrocatalytic processes, such as fuel cells, oxygen reduction reactions, etc.
2. reaction reagent: double ferrocene can generate ferrocene cation in solution through metallization reaction, which is used as electrochemical test and reaction reagent.
3. catalyst: diferrocene can be used as a catalyst for the activation of inert gas methane.
Method:
The preparation of 2,2-bis-ferrocene propane is usually accomplished by the reaction of ferrocene and 1,4-dibromobutane. The reaction conditions may be such that an excess amount of ferrocene and an appropriate amount of sodium iodide are added to the solution under a nitrogen atmosphere, and then 1,4-dibromobutane is added and heated.
Safety Information:
1. 2,2-diferrocene propane is irritating to eyes and skin, please pay attention to protective measures and avoid direct contact.
2. When preparing or using it, it should be operated in a well-ventilated place and appropriate personal protective measures should be taken.
3. In a humid environment, 2,2-diferrocene propane may have a corrosive reaction, so it should be stored in a dry place and avoid contact with water.
Please note that 2,2-diferrocene propane is an organometallic compound, and it is necessary to pay attention to safety and comply with the corresponding laboratory operating specifications during preparation and operation.
Last Update:2024-04-10 22:29:15