| Product Name | ethyl nicotinate |
| Synonyms | ethyl nicotinate Ethyl nicotinoate Ethyl Nicontinate RARECHEM AL BI 0185 Nicotinic acid ethylester NICOTINIC ACID ETHYL ESTER Nicotinic acid ethyl ester |
| CAS | 614-18-6 |
| EINECS | 210-370-7 |
| Chemical Formula | C8H9NO2 |
| Molecular Weight | 151.16 |
| inchi | InChI=1/C8H9NO2/c1-2-11-8(10)7-4-3-5-9-6-7/h3-6H,2H2,1H3 |
| Package | Email to quote |
| Price | Email to quote |
| Descriptions | |
| Supplier Website | |
| Last Update | 2024-04-17 17:21:03 |