| Product Name | Glycol diglycidyl ether |
| Synonyms | QUETOL 651 ZERENEX ZX005288 QUETOL 651, RESIN Ethylene glycol digl Glycol diglycidyl ether 1,2-bis(2,3-epoxypropoxy)-ethan Ethylene glycol diglycidyl ether |
| CAS | 2224-15-9 |
| EINECS | 218-746-2 |
| Chemical Formula | C8H14O4 |
| Molecular Weight | 174.19 |
| inchi | InChI=1/C6H10O3.C2H4/c1(5-3-8-5)7-2-6-4-9-6;1-2/h5-6H,1-4H2;1-2H2 |
| Package | Email to quote |
| Price | Email to quote |
| Descriptions | |
| Supplier Website | |
| Last Update | 2026-01-30 10:03:51 |